About tert-butyl 4,4-difluoro-3-(2-hydroxyethyl)piperidine-1-carboxylate
tert-butyl 4,4-difluoro-3-(2-hydroxyethyl)piperidine-1-carboxylate (PubChem CID 131997137) has the molecular formula C12H21F2NO3
and a molecular weight of 265.30 g/mol. Its IUPAC name is tert-butyl 4,4-difluoro-3-(2-hydroxyethyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4,4-difluoro-3-(2-hydroxyethyl)piperidine-1-carboxylate |
| PubChem CID | 131997137 |
| Molecular Formula | C12H21F2NO3 |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | tert-butyl 4,4-difluoro-3-(2-hydroxyethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(F)C(CCO)C1 |
| InChI | InChI=1S/C12H21F2NO3/c1-11(2,3)18-10(17)15-6-5-12(13,14)9(8-15)4-7-16/h9,16H,4-8H2,1-3H3 |
| InChIKey | PURTYQCBTCHPBP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 4,4-difluoro-3-(2-hydroxyethyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4,4-difluoro-3-(2-hydroxyethyl)piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4,4-difluoro-3-(2-hydroxyethyl)piperidine-1-carboxylate (CID 131997137) is tert-butyl 4,4-difluoro-3-(2-hydroxyethyl)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4,4-difluoro-3-(2-hydroxyethyl)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4,4-difluoro-3-(2-hydroxyethyl)piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(F)(F)C(CCO)C1.
What is the InChIKey of tert-butyl 4,4-difluoro-3-(2-hydroxyethyl)piperidine-1-carboxylate?
The InChIKey is PURTYQCBTCHPBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2NO3/c1-11(2,3)18-10(17)15-6-5-12(13,14)9(8-15)4-7-16/h9,16H,4-8H2,1-3H3.
What are the key properties of tert-butyl 4,4-difluoro-3-(2-hydroxyethyl)piperidine-1-carboxylate?
tert-butyl 4,4-difluoro-3-(2-hydroxyethyl)piperidine-1-carboxylate has a molecular weight of 265.30 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4,4-difluoro-3-(2-hydroxyethyl)piperidine-1-carboxylate is sourced from PubChem (CID 131997137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).