C22H28N4O4 — CID 131997241
4-N-[3-(5-amino-1,3-dioxan-2-yl)propyl]-6-benzyl-2-N-methylpyridine-2,4-dicarboxamide (PubChem CID 131997241) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-N-[3-(5-amino-1,3-dioxan-2-yl)propyl]-6-benzyl-2-N-methylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-[3-(5-amino-1,3-dioxan-2-yl)propyl]-6-benzyl-2-N-methylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 131997241 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 4-N-[3-(5-amino-1,3-dioxan-2-yl)propyl]-6-benzyl-2-N-methylpyridine-2,4-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NCCCC2OCC(N)CO2)cc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C22H28N4O4/c1-24-22(28)19-12-16(11-18(26-19)10-15-6-3-2-4-7-15)21(27)25-9-5-8-20-29-13-17(23)14-30-20/h2-4,6-7,11-12,17,20H,5,8-10,13-14,23H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | KMRAVKISGZIARI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|