C15H23NO8 — CID 131997445
(6,7-diacetyloxy-1,2-dimethyl-2,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]oxazol-5-yl)methyl acetate (PubChem CID 131997445) has the molecular formula C15H23NO8 and a molecular weight of 345.35 g/mol. Its IUPAC name is (6,7-diacetyloxy-1,2-dimethyl-2,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]oxazol-5-yl)methyl acetate.
| Compound Name | (6,7-diacetyloxy-1,2-dimethyl-2,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]oxazol-5-yl)methyl acetate |
|---|---|
| PubChem CID | 131997445 |
| Molecular Formula | C15H23NO8 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (6,7-diacetyloxy-1,2-dimethyl-2,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]oxazol-5-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC2OC(C)N(C)C2C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C15H23NO8/c1-7-16(5)12-14(23-10(4)19)13(22-9(3)18)11(6-20-8(2)17)24-15(12)21-7/h7,11-15H,6H2,1-5H3 |
| InChIKey | NNTMVBIDWZDHCX-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|