About 5-tert-butyl-2-methyl-4,6-dihydro-3H-pyrrolo[2,3-c]pyrrole
5-tert-butyl-2-methyl-4,6-dihydro-3H-pyrrolo[2,3-c]pyrrole (PubChem CID 131997924) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 5-tert-butyl-2-methyl-4,6-dihydro-3H-pyrrolo[2,3-c]pyrrole.
Molecular Properties
| Compound Name | 5-tert-butyl-2-methyl-4,6-dihydro-3H-pyrrolo[2,3-c]pyrrole |
| PubChem CID | 131997924 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 5-tert-butyl-2-methyl-4,6-dihydro-3H-pyrrolo[2,3-c]pyrrole |
| SMILES | CC1=NC2=C(C1)CN(C(C)(C)C)C2 |
| InChI | InChI=1S/C11H18N2/c1-8-5-9-6-13(11(2,3)4)7-10(9)12-8/h5-7H2,1-4H3 |
| InChIKey | JPALBAYJYBAYNN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-tert-butyl-2-methyl-4,6-dihydro-3H-pyrrolo[2,3-c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2-methyl-4,6-dihydro-3H-pyrrolo[2,3-c]pyrrole?
The IUPAC name of 5-tert-butyl-2-methyl-4,6-dihydro-3H-pyrrolo[2,3-c]pyrrole (CID 131997924) is 5-tert-butyl-2-methyl-4,6-dihydro-3H-pyrrolo[2,3-c]pyrrole.
What is the SMILES notation for 5-tert-butyl-2-methyl-4,6-dihydro-3H-pyrrolo[2,3-c]pyrrole?
The canonical SMILES for 5-tert-butyl-2-methyl-4,6-dihydro-3H-pyrrolo[2,3-c]pyrrole is CC1=NC2=C(C1)CN(C(C)(C)C)C2.
What is the InChIKey of 5-tert-butyl-2-methyl-4,6-dihydro-3H-pyrrolo[2,3-c]pyrrole?
The InChIKey is JPALBAYJYBAYNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-8-5-9-6-13(11(2,3)4)7-10(9)12-8/h5-7H2,1-4H3.
What are the key properties of 5-tert-butyl-2-methyl-4,6-dihydro-3H-pyrrolo[2,3-c]pyrrole?
5-tert-butyl-2-methyl-4,6-dihydro-3H-pyrrolo[2,3-c]pyrrole has a molecular weight of 178.28 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2-methyl-4,6-dihydro-3H-pyrrolo[2,3-c]pyrrole is sourced from PubChem (CID 131997924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).