About 3-methyl-5-propan-2-yl-4,6-dihydro-2H-pyrrolo[3,4-b]pyrrole
3-methyl-5-propan-2-yl-4,6-dihydro-2H-pyrrolo[3,4-b]pyrrole (PubChem CID 131997938) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is 3-methyl-5-propan-2-yl-4,6-dihydro-2H-pyrrolo[3,4-b]pyrrole.
Molecular Properties
| Compound Name | 3-methyl-5-propan-2-yl-4,6-dihydro-2H-pyrrolo[3,4-b]pyrrole |
| PubChem CID | 131997938 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 3-methyl-5-propan-2-yl-4,6-dihydro-2H-pyrrolo[3,4-b]pyrrole |
| SMILES | CC1=C2CN(C(C)C)CC2=NC1 |
| InChI | InChI=1S/C10H16N2/c1-7(2)12-5-9-8(3)4-11-10(9)6-12/h7H,4-6H2,1-3H3 |
| InChIKey | MGAUFYCLZSJWBW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-5-propan-2-yl-4,6-dihydro-2H-pyrrolo[3,4-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-propan-2-yl-4,6-dihydro-2H-pyrrolo[3,4-b]pyrrole?
The IUPAC name of 3-methyl-5-propan-2-yl-4,6-dihydro-2H-pyrrolo[3,4-b]pyrrole (CID 131997938) is 3-methyl-5-propan-2-yl-4,6-dihydro-2H-pyrrolo[3,4-b]pyrrole.
What is the SMILES notation for 3-methyl-5-propan-2-yl-4,6-dihydro-2H-pyrrolo[3,4-b]pyrrole?
The canonical SMILES for 3-methyl-5-propan-2-yl-4,6-dihydro-2H-pyrrolo[3,4-b]pyrrole is CC1=C2CN(C(C)C)CC2=NC1.
What is the InChIKey of 3-methyl-5-propan-2-yl-4,6-dihydro-2H-pyrrolo[3,4-b]pyrrole?
The InChIKey is MGAUFYCLZSJWBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2/c1-7(2)12-5-9-8(3)4-11-10(9)6-12/h7H,4-6H2,1-3H3.
What are the key properties of 3-methyl-5-propan-2-yl-4,6-dihydro-2H-pyrrolo[3,4-b]pyrrole?
3-methyl-5-propan-2-yl-4,6-dihydro-2H-pyrrolo[3,4-b]pyrrole has a molecular weight of 164.25 g/mol, XLogP of 1.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-propan-2-yl-4,6-dihydro-2H-pyrrolo[3,4-b]pyrrole is sourced from PubChem (CID 131997938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).