C11H17F2N3 — CID 131997945
3-(4a,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-yl)-2,2-difluoropropan-1-amine (PubChem CID 131997945) has the molecular formula C11H17F2N3 and a molecular weight of 229.27 g/mol. Its IUPAC name is 3-(4a,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-yl)-2,2-difluoropropan-1-amine.
| Compound Name | 3-(4a,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-yl)-2,2-difluoropropan-1-amine |
|---|---|
| PubChem CID | 131997945 |
| Molecular Formula | C11H17F2N3 |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 3-(4a,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-yl)-2,2-difluoropropan-1-amine |
| SMILES | NCC(F)(F)CC1=NC2NCCCC2C=C1 |
| InChI | InChI=1S/C11H17F2N3/c12-11(13,7-14)6-9-4-3-8-2-1-5-15-10(8)16-9/h3-4,8,10,15H,1-2,5-7,14H2 |
| InChIKey | ICUTUAFVDCXTFO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |