About (2Z,4E)-4-methanimidoylhexa-2,4-dien-1-ol
(2Z,4E)-4-methanimidoylhexa-2,4-dien-1-ol (PubChem CID 131998269) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is (2Z,4E)-4-methanimidoylhexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | (2Z,4E)-4-methanimidoylhexa-2,4-dien-1-ol |
| PubChem CID | 131998269 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (2Z,4E)-4-methanimidoylhexa-2,4-dien-1-ol |
| SMILES | [H]/N=C/C(/C=C\CO)=C/C |
| InChI | InChI=1S/C7H11NO/c1-2-7(6-8)4-3-5-9/h2-4,6,8-9H,5H2,1H3/b4-3-,7-2+,8-6+ |
| InChIKey | SXQKXEOOTWJJEM-CLVPLPJCSA-N |
| XLogP | 1.13 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-4-methanimidoylhexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-4-methanimidoylhexa-2,4-dien-1-ol?
The IUPAC name of (2Z,4E)-4-methanimidoylhexa-2,4-dien-1-ol (CID 131998269) is (2Z,4E)-4-methanimidoylhexa-2,4-dien-1-ol.
What is the SMILES notation for (2Z,4E)-4-methanimidoylhexa-2,4-dien-1-ol?
The canonical SMILES for (2Z,4E)-4-methanimidoylhexa-2,4-dien-1-ol is [H]/N=C/C(/C=C\CO)=C/C.
What is the InChIKey of (2Z,4E)-4-methanimidoylhexa-2,4-dien-1-ol?
The InChIKey is SXQKXEOOTWJJEM-CLVPLPJCSA-N. The full InChI is InChI=1S/C7H11NO/c1-2-7(6-8)4-3-5-9/h2-4,6,8-9H,5H2,1H3/b4-3-,7-2+,8-6+.
What are the key properties of (2Z,4E)-4-methanimidoylhexa-2,4-dien-1-ol?
(2Z,4E)-4-methanimidoylhexa-2,4-dien-1-ol has a molecular weight of 125.17 g/mol, XLogP of 1.13, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-4-methanimidoylhexa-2,4-dien-1-ol is sourced from PubChem (CID 131998269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).