C17H32N2O2 — CID 131998414
trans-(1R,3R)-1-N,1-N,3-N,3-N,2,2-hexamethyl-5-propan-2-ylcyclohexane-1,3-dicarboxamide (PubChem CID 131998414) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is trans-(1R,3R)-1-N,1-N,3-N,3-N,2,2-hexamethyl-5-propan-2-ylcyclohexane-1,3-dicarboxamide.
| Compound Name | trans-(1R,3R)-1-N,1-N,3-N,3-N,2,2-hexamethyl-5-propan-2-ylcyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 131998414 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | trans-(1R,3R)-1-N,1-N,3-N,3-N,2,2-hexamethyl-5-propan-2-ylcyclohexane-1,3-dicarboxamide |
| SMILES | CC(C)C1C[C@@H](C(=O)N(C)C)C(C)(C)[C@H](C(=O)N(C)C)C1 |
| InChI | InChI=1S/C17H32N2O2/c1-11(2)12-9-13(15(20)18(5)6)17(3,4)14(10-12)16(21)19(7)8/h11-14H,9-10H2,1-8H3/t13-,14-/m0/s1 |
| InChIKey | XUUGRKFEEVSNAE-KBPBESRZSA-N |
| XLogP | 2.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |