About tert-butyl N-methyl-N-[2-pyrimidin-5-yl-4-(trifluoromethyl)-1,3-thiazol-5-yl]carbamate
tert-butyl N-methyl-N-[2-pyrimidin-5-yl-4-(trifluoromethyl)-1,3-thiazol-5-yl]carbamate (PubChem CID 131998562) has the molecular formula C14H15F3N4O2S
and a molecular weight of 360.36 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-pyrimidin-5-yl-4-(trifluoromethyl)-1,3-thiazol-5-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-methyl-N-[2-pyrimidin-5-yl-4-(trifluoromethyl)-1,3-thiazol-5-yl]carbamate |
| PubChem CID | 131998562 |
| Molecular Formula | C14H15F3N4O2S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | tert-butyl N-methyl-N-[2-pyrimidin-5-yl-4-(trifluoromethyl)-1,3-thiazol-5-yl]carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1sc(-c2cncnc2)nc1C(F)(F)F |
| InChI | InChI=1S/C14H15F3N4O2S/c1-13(2,3)23-12(22)21(4)11-9(14(15,16)17)20-10(24-11)8-5-18-7-19-6-8/h5-7H,1-4H3 |
| InChIKey | CRAAXSLAAXCWKZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-methyl-N-[2-pyrimidin-5-yl-4-(trifluoromethyl)-1,3-thiazol-5-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-methyl-N-[2-pyrimidin-5-yl-4-(trifluoromethyl)-1,3-thiazol-5-yl]carbamate?
The IUPAC name of tert-butyl N-methyl-N-[2-pyrimidin-5-yl-4-(trifluoromethyl)-1,3-thiazol-5-yl]carbamate (CID 131998562) is tert-butyl N-methyl-N-[2-pyrimidin-5-yl-4-(trifluoromethyl)-1,3-thiazol-5-yl]carbamate.
What is the SMILES notation for tert-butyl N-methyl-N-[2-pyrimidin-5-yl-4-(trifluoromethyl)-1,3-thiazol-5-yl]carbamate?
The canonical SMILES for tert-butyl N-methyl-N-[2-pyrimidin-5-yl-4-(trifluoromethyl)-1,3-thiazol-5-yl]carbamate is CN(C(=O)OC(C)(C)C)c1sc(-c2cncnc2)nc1C(F)(F)F.
What is the InChIKey of tert-butyl N-methyl-N-[2-pyrimidin-5-yl-4-(trifluoromethyl)-1,3-thiazol-5-yl]carbamate?
The InChIKey is CRAAXSLAAXCWKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3N4O2S/c1-13(2,3)23-12(22)21(4)11-9(14(15,16)17)20-10(24-11)8-5-18-7-19-6-8/h5-7H,1-4H3.
What are the key properties of tert-butyl N-methyl-N-[2-pyrimidin-5-yl-4-(trifluoromethyl)-1,3-thiazol-5-yl]carbamate?
tert-butyl N-methyl-N-[2-pyrimidin-5-yl-4-(trifluoromethyl)-1,3-thiazol-5-yl]carbamate has a molecular weight of 360.36 g/mol, XLogP of 3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-methyl-N-[2-pyrimidin-5-yl-4-(trifluoromethyl)-1,3-thiazol-5-yl]carbamate is sourced from PubChem (CID 131998562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).