C16H15N3O10S — CID 131998890
[3,4,5-trihydroxy-6-[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenoxy]oxan-2-yl] formate (PubChem CID 131998890) has the molecular formula C16H15N3O10S and a molecular weight of 441.37 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenoxy]oxan-2-yl] formate.
| Compound Name | [3,4,5-trihydroxy-6-[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenoxy]oxan-2-yl] formate |
|---|---|
| PubChem CID | 131998890 |
| Molecular Formula | C16H15N3O10S |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | [3,4,5-trihydroxy-6-[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenoxy]oxan-2-yl] formate |
| SMILES | O=COC1OC(Oc2ccccc2C(=O)Nc2ncc([N+](=O)[O-])s2)C(O)C(O)C1O |
| InChI | InChI=1S/C16H15N3O10S/c20-6-27-14-11(22)10(21)12(23)15(29-14)28-8-4-2-1-3-7(8)13(24)18-16-17-5-9(30-16)19(25)26/h1-6,10-12,14-15,21-23H,(H,17,18,24) |
| InChIKey | DOWOMYMUXQTVLS-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 190.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|