C11H12O5 — CID 131998929
methyl (1R,6S,8R)-4-oxo-3,11-dioxatricyclo[6.2.1.01,6]undec-9-ene-6-carboxylate (PubChem CID 131998929) has the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. Its IUPAC name is methyl (1R,6S,8R)-4-oxo-3,11-dioxatricyclo[6.2.1.01,6]undec-9-ene-6-carboxylate.
| Compound Name | methyl (1R,6S,8R)-4-oxo-3,11-dioxatricyclo[6.2.1.01,6]undec-9-ene-6-carboxylate |
|---|---|
| PubChem CID | 131998929 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | methyl (1R,6S,8R)-4-oxo-3,11-dioxatricyclo[6.2.1.01,6]undec-9-ene-6-carboxylate |
| SMILES | COC(=O)[C@@]12CC(=O)OC[C@@]13C=C[C@@H](C2)O3 |
| InChI | InChI=1S/C11H12O5/c1-14-9(13)10-4-7-2-3-11(10,16-7)6-15-8(12)5-10/h2-3,7H,4-6H2,1H3/t7-,10+,11-/m0/s1 |
| InChIKey | OXEMEPZLTUDJQR-XROYCOCOSA-N |
| XLogP | 0.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|