C12H17N3S — CID 131999173
6-cycloheptyl-2-methylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 131999173) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is 6-cycloheptyl-2-methylimidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 6-cycloheptyl-2-methylimidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 131999173 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 6-cycloheptyl-2-methylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | Cc1nn2cc(C3CCCCCC3)nc2s1 |
| InChI | InChI=1S/C12H17N3S/c1-9-14-15-8-11(13-12(15)16-9)10-6-4-2-3-5-7-10/h8,10H,2-7H2,1H3 |
| InChIKey | VAIZGLXNDQPQJF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |