About 1-[(Z)-but-1-enyl]-4,4-dimethyl-3H-isoquinoline
1-[(Z)-but-1-enyl]-4,4-dimethyl-3H-isoquinoline (PubChem CID 131999426) has the molecular formula C15H19N
and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-[(Z)-but-1-enyl]-4,4-dimethyl-3H-isoquinoline.
Molecular Properties
| Compound Name | 1-[(Z)-but-1-enyl]-4,4-dimethyl-3H-isoquinoline |
| PubChem CID | 131999426 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 1-[(Z)-but-1-enyl]-4,4-dimethyl-3H-isoquinoline |
| SMILES | CC/C=C\C1=NCC(C)(C)c2ccccc21 |
| InChI | InChI=1S/C15H19N/c1-4-5-10-14-12-8-6-7-9-13(12)15(2,3)11-16-14/h5-10H,4,11H2,1-3H3/b10-5- |
| InChIKey | WWFJGOWPCHJDHE-YHYXMXQVSA-N |
| XLogP | 3.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(Z)-but-1-enyl]-4,4-dimethyl-3H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-but-1-enyl]-4,4-dimethyl-3H-isoquinoline?
The IUPAC name of 1-[(Z)-but-1-enyl]-4,4-dimethyl-3H-isoquinoline (CID 131999426) is 1-[(Z)-but-1-enyl]-4,4-dimethyl-3H-isoquinoline.
What is the SMILES notation for 1-[(Z)-but-1-enyl]-4,4-dimethyl-3H-isoquinoline?
The canonical SMILES for 1-[(Z)-but-1-enyl]-4,4-dimethyl-3H-isoquinoline is CC/C=C\C1=NCC(C)(C)c2ccccc21.
What is the InChIKey of 1-[(Z)-but-1-enyl]-4,4-dimethyl-3H-isoquinoline?
The InChIKey is WWFJGOWPCHJDHE-YHYXMXQVSA-N. The full InChI is InChI=1S/C15H19N/c1-4-5-10-14-12-8-6-7-9-13(12)15(2,3)11-16-14/h5-10H,4,11H2,1-3H3/b10-5-.
What are the key properties of 1-[(Z)-but-1-enyl]-4,4-dimethyl-3H-isoquinoline?
1-[(Z)-but-1-enyl]-4,4-dimethyl-3H-isoquinoline has a molecular weight of 213.32 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-but-1-enyl]-4,4-dimethyl-3H-isoquinoline is sourced from PubChem (CID 131999426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).