About 3-(benzylamino)hexanoic acid
3-(benzylamino)hexanoic acid (PubChem CID 13200147) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-(benzylamino)hexanoic acid.
Molecular Properties
| Compound Name | 3-(benzylamino)hexanoic acid |
| PubChem CID | 13200147 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 3-(benzylamino)hexanoic acid |
| SMILES | CCCC(CC(=O)O)NCc1ccccc1 |
| InChI | InChI=1S/C13H19NO2/c1-2-6-12(9-13(15)16)14-10-11-7-4-3-5-8-11/h3-5,7-8,12,14H,2,6,9-10H2,1H3,(H,15,16) |
| InChIKey | JQKKEYCMOYWIOU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(benzylamino)hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzylamino)hexanoic acid?
The IUPAC name of 3-(benzylamino)hexanoic acid (CID 13200147) is 3-(benzylamino)hexanoic acid.
What is the SMILES notation for 3-(benzylamino)hexanoic acid?
The canonical SMILES for 3-(benzylamino)hexanoic acid is CCCC(CC(=O)O)NCc1ccccc1.
What is the InChIKey of 3-(benzylamino)hexanoic acid?
The InChIKey is JQKKEYCMOYWIOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-2-6-12(9-13(15)16)14-10-11-7-4-3-5-8-11/h3-5,7-8,12,14H,2,6,9-10H2,1H3,(H,15,16).
What are the key properties of 3-(benzylamino)hexanoic acid?
3-(benzylamino)hexanoic acid has a molecular weight of 221.30 g/mol, XLogP of 2.42, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzylamino)hexanoic acid is sourced from PubChem (CID 13200147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).