About 3,4-dimethyloxan-2-one
3,4-dimethyloxan-2-one (PubChem CID 13200721) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is 3,4-dimethyloxan-2-one.
Molecular Properties
| Compound Name | 3,4-dimethyloxan-2-one |
| PubChem CID | 13200721 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 3,4-dimethyloxan-2-one |
| SMILES | CC1CCOC(=O)C1C |
| InChI | InChI=1S/C7H12O2/c1-5-3-4-9-7(8)6(5)2/h5-6H,3-4H2,1-2H3 |
| InChIKey | ANCHTJLAENBUPA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dimethyloxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyloxan-2-one?
The IUPAC name of 3,4-dimethyloxan-2-one (CID 13200721) is 3,4-dimethyloxan-2-one.
What is the SMILES notation for 3,4-dimethyloxan-2-one?
The canonical SMILES for 3,4-dimethyloxan-2-one is CC1CCOC(=O)C1C.
What is the InChIKey of 3,4-dimethyloxan-2-one?
The InChIKey is ANCHTJLAENBUPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-5-3-4-9-7(8)6(5)2/h5-6H,3-4H2,1-2H3.
What are the key properties of 3,4-dimethyloxan-2-one?
3,4-dimethyloxan-2-one has a molecular weight of 128.17 g/mol, XLogP of 1.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyloxan-2-one is sourced from PubChem (CID 13200721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).