C18H26O10 — CID 132010195
4-[(E)-2-carboxyethenyl]-4-hydroxy-5-[2-(2-hydroxypropoxy)propoxy]-5-methylocta-2,6-dienedioic acid (PubChem CID 132010195) has the molecular formula C18H26O10 and a molecular weight of 402.40 g/mol. Its IUPAC name is 4-[(E)-2-carboxyethenyl]-4-hydroxy-5-[2-(2-hydroxypropoxy)propoxy]-5-methylocta-2,6-dienedioic acid.
| Compound Name | 4-[(E)-2-carboxyethenyl]-4-hydroxy-5-[2-(2-hydroxypropoxy)propoxy]-5-methylocta-2,6-dienedioic acid |
|---|---|
| PubChem CID | 132010195 |
| Molecular Formula | C18H26O10 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 4-[(E)-2-carboxyethenyl]-4-hydroxy-5-[2-(2-hydroxypropoxy)propoxy]-5-methylocta-2,6-dienedioic acid |
| SMILES | CC(COC(C)COC(C)(C=CC(=O)O)C(C=CC(=O)O)(/C=C/C(=O)O)O)O |
| InChI | InChI=1S/C18H26O10/c1-12(19)10-27-13(2)11-28-17(3,7-4-14(20)21)18(26,8-5-15(22)23)9-6-16(24)25/h4-9,12-13,19,26H,10-11H2,1-3H3,(H,20,21)(H,22,23)(H,24,25)/b7-4?,8-5+,9-6? |
| InChIKey | XDJKUUKFLQTNNI-CJCIPTCGSA-N |
| XLogP | -0.90 |
| TPSA | 171.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | 612 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|