C17H14F3N3O4S — CID 1320228
N-(3-acetamidophenyl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide (PubChem CID 1320228) has the molecular formula C17H14F3N3O4S and a molecular weight of 413.38 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide.
| Compound Name | N-(3-acetamidophenyl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 1320228 |
| Molecular Formula | C17H14F3N3O4S |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | N-(3-acetamidophenyl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)CSc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H14F3N3O4S/c1-10(24)21-12-3-2-4-13(8-12)22-16(25)9-28-15-6-5-11(17(18,19)20)7-14(15)23(26)27/h2-8H,9H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | FJDOFMDFSCCNQA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|