C18H20ClN — CID 13202964
(6R,10bS)-6-phenyl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;hydrochloride (PubChem CID 13202964) has the molecular formula C18H20ClN and a molecular weight of 285.82 g/mol. Its IUPAC name is (6R,10bS)-6-phenyl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;hydrochloride.
| Compound Name | (6R,10bS)-6-phenyl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 13202964 |
| Molecular Formula | C18H20ClN |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | (6R,10bS)-6-phenyl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;hydrochloride |
| SMILES | Cl.c1ccc([C@H]2CN3CCC[C@H]3c3ccccc32)cc1 |
| InChI | InChI=1S/C18H19N.ClH/c1-2-7-14(8-3-1)17-13-19-12-6-11-18(19)16-10-5-4-9-15(16)17;/h1-5,7-10,17-18H,6,11-13H2;1H/t17-,18+;/m1./s1 |
| InChIKey | YXFYPWNHKYOINK-URBRKQAFSA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |