C25H15NO4S2 — CID 1320298
4-[5-[(3-naphthalen-1-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 1320298) has the molecular formula C25H15NO4S2 and a molecular weight of 457.53 g/mol. Its IUPAC name is 4-[5-[(3-naphthalen-1-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[(3-naphthalen-1-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 1320298 |
| Molecular Formula | C25H15NO4S2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 4-[5-[(3-naphthalen-1-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(C=C3SC(=S)N(c4cccc5ccccc45)C3=O)o2)cc1 |
| InChI | InChI=1S/C25H15NO4S2/c27-23-22(14-18-12-13-21(30-18)16-8-10-17(11-9-16)24(28)29)32-25(31)26(23)20-7-3-5-15-4-1-2-6-19(15)20/h1-14H,(H,28,29) |
| InChIKey | YZTDYXPBDVGGOG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|