C19H21N — CID 13203000
7-phenyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine (PubChem CID 13203000) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 7-phenyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine.
| Compound Name | 7-phenyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine |
|---|---|
| PubChem CID | 13203000 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 7-phenyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine |
| SMILES | c1ccc(C2CN3CCCCC3c3ccccc32)cc1 |
| InChI | InChI=1S/C19H21N/c1-2-8-15(9-3-1)18-14-20-13-7-6-12-19(20)17-11-5-4-10-16(17)18/h1-5,8-11,18-19H,6-7,12-14H2 |
| InChIKey | RDHQAERKGRHFCB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |