About 2-methyl-5,6-dipropyl-2,3-dihydro-1,4-dithiine
2-methyl-5,6-dipropyl-2,3-dihydro-1,4-dithiine (PubChem CID 13203357) has the molecular formula C11H20S2
and a molecular weight of 216.41 g/mol. Its IUPAC name is 2-methyl-5,6-dipropyl-2,3-dihydro-1,4-dithiine.
Molecular Properties
| Compound Name | 2-methyl-5,6-dipropyl-2,3-dihydro-1,4-dithiine |
| PubChem CID | 13203357 |
| Molecular Formula | C11H20S2 |
| Molecular Weight | 216.41 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2-methyl-5,6-dipropyl-2,3-dihydro-1,4-dithiine |
| SMILES | CCCC1=C(CCC)SC(C)CS1 |
| InChI | InChI=1S/C11H20S2/c1-4-6-10-11(7-5-2)13-9(3)8-12-10/h9H,4-8H2,1-3H3 |
| InChIKey | ABBZAFKMTJQVSR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-5,6-dipropyl-2,3-dihydro-1,4-dithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5,6-dipropyl-2,3-dihydro-1,4-dithiine?
The IUPAC name of 2-methyl-5,6-dipropyl-2,3-dihydro-1,4-dithiine (CID 13203357) is 2-methyl-5,6-dipropyl-2,3-dihydro-1,4-dithiine.
What is the SMILES notation for 2-methyl-5,6-dipropyl-2,3-dihydro-1,4-dithiine?
The canonical SMILES for 2-methyl-5,6-dipropyl-2,3-dihydro-1,4-dithiine is CCCC1=C(CCC)SC(C)CS1.
What is the InChIKey of 2-methyl-5,6-dipropyl-2,3-dihydro-1,4-dithiine?
The InChIKey is ABBZAFKMTJQVSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20S2/c1-4-6-10-11(7-5-2)13-9(3)8-12-10/h9H,4-8H2,1-3H3.
What are the key properties of 2-methyl-5,6-dipropyl-2,3-dihydro-1,4-dithiine?
2-methyl-5,6-dipropyl-2,3-dihydro-1,4-dithiine has a molecular weight of 216.41 g/mol, XLogP of 4.67, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5,6-dipropyl-2,3-dihydro-1,4-dithiine is sourced from PubChem (CID 13203357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).