C8H15N7 — CID 13203368
6-(4-methylpiperazin-1-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 13203368) has the molecular formula C8H15N7 and a molecular weight of 209.26 g/mol. Its IUPAC name is 6-(4-methylpiperazin-1-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(4-methylpiperazin-1-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 13203368 |
| Molecular Formula | C8H15N7 |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 6-(4-methylpiperazin-1-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CN1CCN(c2nc(N)nc(N)n2)CC1 |
| InChI | InChI=1S/C8H15N7/c1-14-2-4-15(5-3-14)8-12-6(9)11-7(10)13-8/h2-5H2,1H3,(H4,9,10,11,12,13) |
| InChIKey | HRQGDUJSSJGYLC-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |