About N-ethyl-N-propylaniline
N-ethyl-N-propylaniline (PubChem CID 13203875) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is N-ethyl-N-propylaniline.
Molecular Properties
| Compound Name | N-ethyl-N-propylaniline |
| PubChem CID | 13203875 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | N-ethyl-N-propylaniline |
| SMILES | CCCN(CC)c1ccccc1 |
| InChI | InChI=1S/C11H17N/c1-3-10-12(4-2)11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | PAZVJIOFFOOQLQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-N-propylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-propylaniline?
The IUPAC name of N-ethyl-N-propylaniline (CID 13203875) is N-ethyl-N-propylaniline.
What is the SMILES notation for N-ethyl-N-propylaniline?
The canonical SMILES for N-ethyl-N-propylaniline is CCCN(CC)c1ccccc1.
What is the InChIKey of N-ethyl-N-propylaniline?
The InChIKey is PAZVJIOFFOOQLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-3-10-12(4-2)11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3.
What are the key properties of N-ethyl-N-propylaniline?
N-ethyl-N-propylaniline has a molecular weight of 163.26 g/mol, XLogP of 2.92, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-propylaniline is sourced from PubChem (CID 13203875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).