About 2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-cyclopentylacetamide
2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-cyclopentylacetamide (PubChem CID 1320406) has the molecular formula C21H26N2O3S
and a molecular weight of 386.52 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-cyclopentylacetamide.
Molecular Properties
| Compound Name | 2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-cyclopentylacetamide |
| PubChem CID | 1320406 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-cyclopentylacetamide |
| SMILES | Cc1cccc(N(CC(=O)NC2CCCC2)S(=O)(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C21H26N2O3S/c1-16-9-8-14-20(17(16)2)23(15-21(24)22-18-10-6-7-11-18)27(25,26)19-12-4-3-5-13-19/h3-5,8-9,12-14,18H,6-7,10-11,15H2,1-2H3,(H,22,24) |
| InChIKey | KUUIJYGDAQMAGO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-cyclopentylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-cyclopentylacetamide?
The IUPAC name of 2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-cyclopentylacetamide (CID 1320406) is 2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-cyclopentylacetamide.
What is the SMILES notation for 2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-cyclopentylacetamide?
The canonical SMILES for 2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-cyclopentylacetamide is Cc1cccc(N(CC(=O)NC2CCCC2)S(=O)(=O)c2ccccc2)c1C.
What is the InChIKey of 2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-cyclopentylacetamide?
The InChIKey is KUUIJYGDAQMAGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O3S/c1-16-9-8-14-20(17(16)2)23(15-21(24)22-18-10-6-7-11-18)27(25,26)19-12-4-3-5-13-19/h3-5,8-9,12-14,18H,6-7,10-11,15H2,1-2H3,(H,22,24).
What are the key properties of 2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-cyclopentylacetamide?
2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-cyclopentylacetamide has a molecular weight of 386.52 g/mol, XLogP of 3.56, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[N-(benzenesulfonyl)-2,3-dimethylanilino]-N-cyclopentylacetamide is sourced from PubChem (CID 1320406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).