C8H9F9O2 — CID 13204822
1-ethoxy-3,3,4,4,5,5,6,6,6-nonafluorohexan-2-ol (PubChem CID 13204822) has the molecular formula C8H9F9O2 and a molecular weight of 308.14 g/mol. Its IUPAC name is 1-ethoxy-3,3,4,4,5,5,6,6,6-nonafluorohexan-2-ol.
| Compound Name | 1-ethoxy-3,3,4,4,5,5,6,6,6-nonafluorohexan-2-ol |
|---|---|
| PubChem CID | 13204822 |
| Molecular Formula | C8H9F9O2 |
| Molecular Weight | 308.14 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 1-ethoxy-3,3,4,4,5,5,6,6,6-nonafluorohexan-2-ol |
| SMILES | CCOCC(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F9O2/c1-2-19-3-4(18)5(9,10)6(11,12)7(13,14)8(15,16)17/h4,18H,2-3H2,1H3 |
| InChIKey | CFHMZROKMSLQRX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.14 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|