About hept-6-ynimidamide
hept-6-ynimidamide (PubChem CID 13205709) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is hept-6-ynimidamide.
Molecular Properties
| Compound Name | hept-6-ynimidamide |
| PubChem CID | 13205709 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | hept-6-ynimidamide |
| SMILES | [H]/N=C(\N)CCCCC#C |
| InChI | InChI=1S/C7H12N2/c1-2-3-4-5-6-7(8)9/h1H,3-6H2,(H3,8,9) |
| InChIKey | IDAPIMSTVMAMHW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hept-6-ynimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-6-ynimidamide?
The IUPAC name of hept-6-ynimidamide (CID 13205709) is hept-6-ynimidamide.
What is the SMILES notation for hept-6-ynimidamide?
The canonical SMILES for hept-6-ynimidamide is [H]/N=C(\N)CCCCC#C.
What is the InChIKey of hept-6-ynimidamide?
The InChIKey is IDAPIMSTVMAMHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-2-3-4-5-6-7(8)9/h1H,3-6H2,(H3,8,9).
What are the key properties of hept-6-ynimidamide?
hept-6-ynimidamide has a molecular weight of 124.19 g/mol, XLogP of 1.12, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hept-6-ynimidamide is sourced from PubChem (CID 13205709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).