2-(8-chloro-1,2,3,4-tetrahydroquinolin-6-yl)propanoic acid

C12H14ClNO2 — CID 13206071

IUPAC2-(8-chloro-1,2,3,4-tetrahydroquinolin-6-yl)propanoic acid
SMILESCC(C(=O)O)c1cc(Cl)c2c(c1)CCCN2
InChIInChI=1S/C12H14ClNO2/c1-7(12(15)16)9-5-8-3-2-4-14-11(8)10(13)6-9/h5-7,14H,2-4H2,1H3,(H,15,16)
InChIKeyXTZMVJZDKRIULA-UHFFFAOYSA-N
MW239.70 g/mol
LogP2.89
Rot. Bonds2

About 2-(8-chloro-1,2,3,4-tetrahydroquinolin-6-yl)propanoic acid

2-(8-chloro-1,2,3,4-tetrahydroquinolin-6-yl)propanoic acid (PubChem CID 13206071) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is 2-(8-chloro-1,2,3,4-tetrahydroquinolin-6-yl)propanoic acid.

Molecular Properties

Compound Name2-(8-chloro-1,2,3,4-tetrahydroquinolin-6-yl)propanoic acid
PubChem CID13206071
Molecular FormulaC12H14ClNO2
Molecular Weight239.70 g/mol
Exact Mass239.07
IUPAC Name2-(8-chloro-1,2,3,4-tetrahydroquinolin-6-yl)propanoic acid
SMILESCC(C(=O)O)c1cc(Cl)c2c(c1)CCCN2
InChIInChI=1S/C12H14ClNO2/c1-7(12(15)16)9-5-8-3-2-4-14-11(8)10(13)6-9/h5-7,14H,2-4H2,1H3,(H,15,16)
InChIKeyXTZMVJZDKRIULA-UHFFFAOYSA-N
XLogP2.89
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.70
LogP ≤ 52.89
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(8-chloro-1,2,3,4-tetrahydroquinolin-6-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(8-chloro-1,2,3,4-tetrahydroquinolin-6-yl)propanoic acid?
The IUPAC name of 2-(8-chloro-1,2,3,4-tetrahydroquinolin-6-yl)propanoic acid (CID 13206071) is 2-(8-chloro-1,2,3,4-tetrahydroquinolin-6-yl)propanoic acid.
What is the SMILES notation for 2-(8-chloro-1,2,3,4-tetrahydroquinolin-6-yl)propanoic acid?
The canonical SMILES for 2-(8-chloro-1,2,3,4-tetrahydroquinolin-6-yl)propanoic acid is CC(C(=O)O)c1cc(Cl)c2c(c1)CCCN2.
What is the InChIKey of 2-(8-chloro-1,2,3,4-tetrahydroquinolin-6-yl)propanoic acid?
The InChIKey is XTZMVJZDKRIULA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClNO2/c1-7(12(15)16)9-5-8-3-2-4-14-11(8)10(13)6-9/h5-7,14H,2-4H2,1H3,(H,15,16).
What are the key properties of 2-(8-chloro-1,2,3,4-tetrahydroquinolin-6-yl)propanoic acid?
2-(8-chloro-1,2,3,4-tetrahydroquinolin-6-yl)propanoic acid has a molecular weight of 239.70 g/mol, XLogP of 2.89, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-chloro-1,2,3,4-tetrahydroquinolin-6-yl)propanoic acid is sourced from PubChem (CID 13206071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).