About 8-imidazo[1,5-a]pyridin-5-yloctanoic acid
8-imidazo[1,5-a]pyridin-5-yloctanoic acid (PubChem CID 13206140) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 8-imidazo[1,5-a]pyridin-5-yloctanoic acid.
Molecular Properties
| Compound Name | 8-imidazo[1,5-a]pyridin-5-yloctanoic acid |
| PubChem CID | 13206140 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 8-imidazo[1,5-a]pyridin-5-yloctanoic acid |
| SMILES | O=C(O)CCCCCCCc1cccc2cncn12 |
| InChI | InChI=1S/C15H20N2O2/c18-15(19)10-5-3-1-2-4-7-13-8-6-9-14-11-16-12-17(13)14/h6,8-9,11-12H,1-5,7,10H2,(H,18,19) |
| InChIKey | OXXHNQLTJAVHCJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-imidazo[1,5-a]pyridin-5-yloctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-imidazo[1,5-a]pyridin-5-yloctanoic acid?
The IUPAC name of 8-imidazo[1,5-a]pyridin-5-yloctanoic acid (CID 13206140) is 8-imidazo[1,5-a]pyridin-5-yloctanoic acid.
What is the SMILES notation for 8-imidazo[1,5-a]pyridin-5-yloctanoic acid?
The canonical SMILES for 8-imidazo[1,5-a]pyridin-5-yloctanoic acid is O=C(O)CCCCCCCc1cccc2cncn12.
What is the InChIKey of 8-imidazo[1,5-a]pyridin-5-yloctanoic acid?
The InChIKey is OXXHNQLTJAVHCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2/c18-15(19)10-5-3-1-2-4-7-13-8-6-9-14-11-16-12-17(13)14/h6,8-9,11-12H,1-5,7,10H2,(H,18,19).
What are the key properties of 8-imidazo[1,5-a]pyridin-5-yloctanoic acid?
8-imidazo[1,5-a]pyridin-5-yloctanoic acid has a molecular weight of 260.34 g/mol, XLogP of 3.30, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-imidazo[1,5-a]pyridin-5-yloctanoic acid is sourced from PubChem (CID 13206140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).