About 5-imidazo[1,5-a]pyridin-7-ylpentanoic acid
5-imidazo[1,5-a]pyridin-7-ylpentanoic acid (PubChem CID 13206153) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 5-imidazo[1,5-a]pyridin-7-ylpentanoic acid.
Molecular Properties
| Compound Name | 5-imidazo[1,5-a]pyridin-7-ylpentanoic acid |
| PubChem CID | 13206153 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 5-imidazo[1,5-a]pyridin-7-ylpentanoic acid |
| SMILES | O=C(O)CCCCc1ccn2cncc2c1 |
| InChI | InChI=1S/C12H14N2O2/c15-12(16)4-2-1-3-10-5-6-14-9-13-8-11(14)7-10/h5-9H,1-4H2,(H,15,16) |
| InChIKey | SKMSGJQVORUNMZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-imidazo[1,5-a]pyridin-7-ylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-imidazo[1,5-a]pyridin-7-ylpentanoic acid?
The IUPAC name of 5-imidazo[1,5-a]pyridin-7-ylpentanoic acid (CID 13206153) is 5-imidazo[1,5-a]pyridin-7-ylpentanoic acid.
What is the SMILES notation for 5-imidazo[1,5-a]pyridin-7-ylpentanoic acid?
The canonical SMILES for 5-imidazo[1,5-a]pyridin-7-ylpentanoic acid is O=C(O)CCCCc1ccn2cncc2c1.
What is the InChIKey of 5-imidazo[1,5-a]pyridin-7-ylpentanoic acid?
The InChIKey is SKMSGJQVORUNMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c15-12(16)4-2-1-3-10-5-6-14-9-13-8-11(14)7-10/h5-9H,1-4H2,(H,15,16).
What are the key properties of 5-imidazo[1,5-a]pyridin-7-ylpentanoic acid?
5-imidazo[1,5-a]pyridin-7-ylpentanoic acid has a molecular weight of 218.26 g/mol, XLogP of 2.13, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-imidazo[1,5-a]pyridin-7-ylpentanoic acid is sourced from PubChem (CID 13206153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).