C12H14N2O2 — CID 13206153
5-imidazo[1,5-a]pyridin-7-ylpentanoic acid (PubChem CID 13206153) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 5-imidazo[1,5-a]pyridin-7-ylpentanoic acid.
| Compound Name | 5-imidazo[1,5-a]pyridin-7-ylpentanoic acid |
|---|---|
| PubChem CID | 13206153 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 5-imidazo[1,5-a]pyridin-7-ylpentanoic acid |
| SMILES | O=C(O)CCCCc1ccn2cncc2c1 |
| InChI | InChI=1S/C12H14N2O2/c15-12(16)4-2-1-3-10-5-6-14-9-13-8-11(14)7-10/h5-9H,1-4H2,(H,15,16) |
| InChIKey | SKMSGJQVORUNMZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|