About 6-(3-methylimidazo[1,5-a]pyridin-5-yl)hexanoic acid
6-(3-methylimidazo[1,5-a]pyridin-5-yl)hexanoic acid (PubChem CID 13206159) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 6-(3-methylimidazo[1,5-a]pyridin-5-yl)hexanoic acid.
Molecular Properties
| Compound Name | 6-(3-methylimidazo[1,5-a]pyridin-5-yl)hexanoic acid |
| PubChem CID | 13206159 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 6-(3-methylimidazo[1,5-a]pyridin-5-yl)hexanoic acid |
| SMILES | Cc1ncc2cccc(CCCCCC(=O)O)n12 |
| InChI | InChI=1S/C14H18N2O2/c1-11-15-10-13-8-5-7-12(16(11)13)6-3-2-4-9-14(17)18/h5,7-8,10H,2-4,6,9H2,1H3,(H,17,18) |
| InChIKey | DBEWVBGJOIZFEP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-methylimidazo[1,5-a]pyridin-5-yl)hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-methylimidazo[1,5-a]pyridin-5-yl)hexanoic acid?
The IUPAC name of 6-(3-methylimidazo[1,5-a]pyridin-5-yl)hexanoic acid (CID 13206159) is 6-(3-methylimidazo[1,5-a]pyridin-5-yl)hexanoic acid.
What is the SMILES notation for 6-(3-methylimidazo[1,5-a]pyridin-5-yl)hexanoic acid?
The canonical SMILES for 6-(3-methylimidazo[1,5-a]pyridin-5-yl)hexanoic acid is Cc1ncc2cccc(CCCCCC(=O)O)n12.
What is the InChIKey of 6-(3-methylimidazo[1,5-a]pyridin-5-yl)hexanoic acid?
The InChIKey is DBEWVBGJOIZFEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2/c1-11-15-10-13-8-5-7-12(16(11)13)6-3-2-4-9-14(17)18/h5,7-8,10H,2-4,6,9H2,1H3,(H,17,18).
What are the key properties of 6-(3-methylimidazo[1,5-a]pyridin-5-yl)hexanoic acid?
6-(3-methylimidazo[1,5-a]pyridin-5-yl)hexanoic acid has a molecular weight of 246.31 g/mol, XLogP of 2.83, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-methylimidazo[1,5-a]pyridin-5-yl)hexanoic acid is sourced from PubChem (CID 13206159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).