About 4,5-dihydropyrimidine-2,6-diamine
4,5-dihydropyrimidine-2,6-diamine (PubChem CID 13206811) has the molecular formula C4H8N4
and a molecular weight of 112.14 g/mol. Its IUPAC name is 4,5-dihydropyrimidine-2,6-diamine.
Molecular Properties
| Compound Name | 4,5-dihydropyrimidine-2,6-diamine |
| PubChem CID | 13206811 |
| Molecular Formula | C4H8N4 |
| Molecular Weight | 112.14 g/mol |
| Exact Mass | 112.07 |
| IUPAC Name | 4,5-dihydropyrimidine-2,6-diamine |
| SMILES | NC1=NC(N)=NCC1 |
| InChI | InChI=1S/C4H8N4/c5-3-1-2-7-4(6)8-3/h1-2H2,(H4,5,6,7,8) |
| InChIKey | IVZOZYWOHVWCFD-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.14 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dihydropyrimidine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydropyrimidine-2,6-diamine?
The IUPAC name of 4,5-dihydropyrimidine-2,6-diamine (CID 13206811) is 4,5-dihydropyrimidine-2,6-diamine.
What is the SMILES notation for 4,5-dihydropyrimidine-2,6-diamine?
The canonical SMILES for 4,5-dihydropyrimidine-2,6-diamine is NC1=NC(N)=NCC1.
What is the InChIKey of 4,5-dihydropyrimidine-2,6-diamine?
The InChIKey is IVZOZYWOHVWCFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4/c5-3-1-2-7-4(6)8-3/h1-2H2,(H4,5,6,7,8).
What are the key properties of 4,5-dihydropyrimidine-2,6-diamine?
4,5-dihydropyrimidine-2,6-diamine has a molecular weight of 112.14 g/mol, XLogP of -0.94, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydropyrimidine-2,6-diamine is sourced from PubChem (CID 13206811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).