About propan-2-yl 2-(6-methyl-1,3-benzothiazol-3-ium-3-yl)acetate bromide
propan-2-yl 2-(6-methyl-1,3-benzothiazol-3-ium-3-yl)acetate bromide (PubChem CID 13206902) has the molecular formula C13H16BrNO2S
and a molecular weight of 330.25 g/mol. Its IUPAC name is propan-2-yl 2-(6-methyl-1,3-benzothiazol-3-ium-3-yl)acetate bromide.
Molecular Properties
| Compound Name | propan-2-yl 2-(6-methyl-1,3-benzothiazol-3-ium-3-yl)acetate bromide |
| PubChem CID | 13206902 |
| Molecular Formula | C13H16BrNO2S |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | propan-2-yl 2-(6-methyl-1,3-benzothiazol-3-ium-3-yl)acetate bromide |
| SMILES | Cc1ccc2c(c1)sc[n+]2CC(=O)OC(C)C.[Br-] |
| InChI | InChI=1S/C13H16NO2S.BrH/c1-9(2)16-13(15)7-14-8-17-12-6-10(3)4-5-11(12)14;/h4-6,8-9H,7H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | RMBPQXSSIKHTCG-UHFFFAOYSA-M |
| XLogP | -0.55 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-(6-methyl-1,3-benzothiazol-3-ium-3-yl)acetate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-(6-methyl-1,3-benzothiazol-3-ium-3-yl)acetate bromide?
The IUPAC name of propan-2-yl 2-(6-methyl-1,3-benzothiazol-3-ium-3-yl)acetate bromide (CID 13206902) is propan-2-yl 2-(6-methyl-1,3-benzothiazol-3-ium-3-yl)acetate bromide.
What is the SMILES notation for propan-2-yl 2-(6-methyl-1,3-benzothiazol-3-ium-3-yl)acetate bromide?
The canonical SMILES for propan-2-yl 2-(6-methyl-1,3-benzothiazol-3-ium-3-yl)acetate bromide is Cc1ccc2c(c1)sc[n+]2CC(=O)OC(C)C.[Br-].
What is the InChIKey of propan-2-yl 2-(6-methyl-1,3-benzothiazol-3-ium-3-yl)acetate bromide?
The InChIKey is RMBPQXSSIKHTCG-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H16NO2S.BrH/c1-9(2)16-13(15)7-14-8-17-12-6-10(3)4-5-11(12)14;/h4-6,8-9H,7H2,1-3H3;1H/q+1;/p-1.
What are the key properties of propan-2-yl 2-(6-methyl-1,3-benzothiazol-3-ium-3-yl)acetate bromide?
propan-2-yl 2-(6-methyl-1,3-benzothiazol-3-ium-3-yl)acetate bromide has a molecular weight of 330.25 g/mol, XLogP of -0.55, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(6-methyl-1,3-benzothiazol-3-ium-3-yl)acetate bromide is sourced from PubChem (CID 13206902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).