About prop-2-enyl 2-(6-chloro-1,3-benzothiazol-3-ium-3-yl)acetate
prop-2-enyl 2-(6-chloro-1,3-benzothiazol-3-ium-3-yl)acetate (PubChem CID 13206920) has the molecular formula C12H11ClNO2S+
and a molecular weight of 268.75 g/mol. Its IUPAC name is prop-2-enyl 2-(6-chloro-1,3-benzothiazol-3-ium-3-yl)acetate.
Molecular Properties
| Compound Name | prop-2-enyl 2-(6-chloro-1,3-benzothiazol-3-ium-3-yl)acetate |
| PubChem CID | 13206920 |
| Molecular Formula | C12H11ClNO2S+ |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | prop-2-enyl 2-(6-chloro-1,3-benzothiazol-3-ium-3-yl)acetate |
| SMILES | C=CCOC(=O)C[n+]1csc2cc(Cl)ccc21 |
| InChI | InChI=1S/C12H11ClNO2S/c1-2-5-16-12(15)7-14-8-17-11-6-9(13)3-4-10(11)14/h2-4,6,8H,1,5,7H2/q+1 |
| InChIKey | OZERFTARMVBOIP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 2-(6-chloro-1,3-benzothiazol-3-ium-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 2-(6-chloro-1,3-benzothiazol-3-ium-3-yl)acetate?
The IUPAC name of prop-2-enyl 2-(6-chloro-1,3-benzothiazol-3-ium-3-yl)acetate (CID 13206920) is prop-2-enyl 2-(6-chloro-1,3-benzothiazol-3-ium-3-yl)acetate.
What is the SMILES notation for prop-2-enyl 2-(6-chloro-1,3-benzothiazol-3-ium-3-yl)acetate?
The canonical SMILES for prop-2-enyl 2-(6-chloro-1,3-benzothiazol-3-ium-3-yl)acetate is C=CCOC(=O)C[n+]1csc2cc(Cl)ccc21.
What is the InChIKey of prop-2-enyl 2-(6-chloro-1,3-benzothiazol-3-ium-3-yl)acetate?
The InChIKey is OZERFTARMVBOIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClNO2S/c1-2-5-16-12(15)7-14-8-17-11-6-9(13)3-4-10(11)14/h2-4,6,8H,1,5,7H2/q+1.
What are the key properties of prop-2-enyl 2-(6-chloro-1,3-benzothiazol-3-ium-3-yl)acetate?
prop-2-enyl 2-(6-chloro-1,3-benzothiazol-3-ium-3-yl)acetate has a molecular weight of 268.75 g/mol, XLogP of 2.57, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2-(6-chloro-1,3-benzothiazol-3-ium-3-yl)acetate is sourced from PubChem (CID 13206920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).