About 1-cyclohexylethanone
1-cyclohexylethanone (PubChem CID 13207) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is 1-cyclohexylethanone.
Molecular Properties
| Compound Name | 1-cyclohexylethanone |
| PubChem CID | 13207 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 1-cyclohexylethanone |
| SMILES | CC(=O)C1CCCCC1 |
| InChI | InChI=1S/C8H14O/c1-7(9)8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
| InChIKey | RIFKADJTWUGDOV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylethanone?
The IUPAC name of 1-cyclohexylethanone (CID 13207) is 1-cyclohexylethanone.
What is the SMILES notation for 1-cyclohexylethanone?
The canonical SMILES for 1-cyclohexylethanone is CC(=O)C1CCCCC1.
What is the InChIKey of 1-cyclohexylethanone?
The InChIKey is RIFKADJTWUGDOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O/c1-7(9)8-5-3-2-4-6-8/h8H,2-6H2,1H3.
What are the key properties of 1-cyclohexylethanone?
1-cyclohexylethanone has a molecular weight of 126.20 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylethanone is sourced from PubChem (CID 13207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).