About US10703755, Example 365
US10703755, Example 365 (PubChem CID 132076893) has the molecular formula C29H30F2N6O3
and a molecular weight of 548.60 g/mol. Its IUPAC name is tert-butyl 4-[3-fluoro-4-[[8-(5-fluoro-3-pyridinyl)-2-methoxy-6-methylpurin-9-yl]methyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
Molecular Properties
| Compound Name | US10703755, Example 365 |
| PubChem CID | 132076893 |
| Molecular Formula | C29H30F2N6O3 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | tert-butyl 4-[3-fluoro-4-[[8-(5-fluoro-3-pyridinyl)-2-methoxy-6-methylpurin-9-yl]methyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC1=C2C(=NC(=N1)OC)N(C(=N2)C3=CC(=CN=C3)F)CC4=C(C=C(C=C4)C5=CCN(CC5)C(=O)OC(C)(C)C)F |
| InChI | InChI=1S/C29H30F2N6O3/c1-17-24-26(35-27(33-17)39-5)37(25(34-24)21-12-22(30)15-32-14-21)16-20-7-6-19(13-23(20)31)18-8-10-36(11-9-18)28(38)40-29(2,3)4/h6-8,12-15H,9-11,16H2,1-5H3 |
| InChIKey | GYFRKYJYKCEINW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 95.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | 919 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze US10703755, Example 365 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10703755, Example 365?
The IUPAC name of US10703755, Example 365 (CID 132076893) is tert-butyl 4-[3-fluoro-4-[[8-(5-fluoro-3-pyridinyl)-2-methoxy-6-methylpurin-9-yl]methyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for US10703755, Example 365?
The canonical SMILES for US10703755, Example 365 is CC1=C2C(=NC(=N1)OC)N(C(=N2)C3=CC(=CN=C3)F)CC4=C(C=C(C=C4)C5=CCN(CC5)C(=O)OC(C)(C)C)F.
What is the InChIKey of US10703755, Example 365?
The InChIKey is GYFRKYJYKCEINW-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H30F2N6O3/c1-17-24-26(35-27(33-17)39-5)37(25(34-24)21-12-22(30)15-32-14-21)16-20-7-6-19(13-23(20)31)18-8-10-36(11-9-18)28(38)40-29(2,3)4/h6-8,12-15H,9-11,16H2,1-5H3.
What are the key properties of US10703755, Example 365?
US10703755, Example 365 has a molecular weight of 548.60 g/mol, XLogP of 4.20, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for US10703755, Example 365 is sourced from PubChem (CID 132076893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).