C6H9N3 — CID 13208
2,4,6-trimethyl-1,3,5-triazine (PubChem CID 13208) has the molecular formula C6H9N3 and a molecular weight of 123.16 g/mol. Its IUPAC name is 2,4,6-trimethyl-1,3,5-triazine.
| Compound Name | 2,4,6-trimethyl-1,3,5-triazine |
|---|---|
| PubChem CID | 13208 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 2,4,6-trimethyl-1,3,5-triazine |
| SMILES | Cc1nc(C)nc(C)n1 |
| InChI | InChI=1S/C6H9N3/c1-4-7-5(2)9-6(3)8-4/h1-3H3 |
| InChIKey | LASVAZQZFYZNPK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |