About 2,6-dimethylhept-1-en-3-yl acetate
2,6-dimethylhept-1-en-3-yl acetate (PubChem CID 13208266) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 2,6-dimethylhept-1-en-3-yl acetate.
Molecular Properties
| Compound Name | 2,6-dimethylhept-1-en-3-yl acetate |
| PubChem CID | 13208266 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2,6-dimethylhept-1-en-3-yl acetate |
| SMILES | C=C(C)C(CCC(C)C)OC(C)=O |
| InChI | InChI=1S/C11H20O2/c1-8(2)6-7-11(9(3)4)13-10(5)12/h8,11H,3,6-7H2,1-2,4-5H3 |
| InChIKey | PAOLULXRKOTYJZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylhept-1-en-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylhept-1-en-3-yl acetate?
The IUPAC name of 2,6-dimethylhept-1-en-3-yl acetate (CID 13208266) is 2,6-dimethylhept-1-en-3-yl acetate.
What is the SMILES notation for 2,6-dimethylhept-1-en-3-yl acetate?
The canonical SMILES for 2,6-dimethylhept-1-en-3-yl acetate is C=C(C)C(CCC(C)C)OC(C)=O.
What is the InChIKey of 2,6-dimethylhept-1-en-3-yl acetate?
The InChIKey is PAOLULXRKOTYJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-8(2)6-7-11(9(3)4)13-10(5)12/h8,11H,3,6-7H2,1-2,4-5H3.
What are the key properties of 2,6-dimethylhept-1-en-3-yl acetate?
2,6-dimethylhept-1-en-3-yl acetate has a molecular weight of 184.28 g/mol, XLogP of 2.93, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylhept-1-en-3-yl acetate is sourced from PubChem (CID 13208266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).