About 1-O-ethyl 5-O-methyl (2Z)-2-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3,3-dimethylpentanedioate
1-O-ethyl 5-O-methyl (2Z)-2-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3,3-dimethylpentanedioate (PubChem CID 13208592) has the molecular formula C18H34O5Si
and a molecular weight of 358.55 g/mol. Its IUPAC name is 1-O-ethyl 5-O-methyl (2Z)-2-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3,3-dimethylpentanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 5-O-methyl (2Z)-2-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3,3-dimethylpentanedioate |
| PubChem CID | 13208592 |
| Molecular Formula | C18H34O5Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 1-O-ethyl 5-O-methyl (2Z)-2-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3,3-dimethylpentanedioate |
| SMILES | CCOC(=O)/C(=C(/C)O[Si](C)(C)C(C)(C)C)C(C)(C)CC(=O)OC |
| InChI | InChI=1S/C18H34O5Si/c1-11-22-16(20)15(18(6,7)12-14(19)21-8)13(2)23-24(9,10)17(3,4)5/h11-12H2,1-10H3/b15-13+ |
| InChIKey | HPXMNBRMYZDARH-FYWRMAATSA-N |
| XLogP | 4.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 5-O-methyl (2Z)-2-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3,3-dimethylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 5-O-methyl (2Z)-2-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3,3-dimethylpentanedioate?
The IUPAC name of 1-O-ethyl 5-O-methyl (2Z)-2-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3,3-dimethylpentanedioate (CID 13208592) is 1-O-ethyl 5-O-methyl (2Z)-2-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3,3-dimethylpentanedioate.
What is the SMILES notation for 1-O-ethyl 5-O-methyl (2Z)-2-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3,3-dimethylpentanedioate?
The canonical SMILES for 1-O-ethyl 5-O-methyl (2Z)-2-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3,3-dimethylpentanedioate is CCOC(=O)/C(=C(/C)O[Si](C)(C)C(C)(C)C)C(C)(C)CC(=O)OC.
What is the InChIKey of 1-O-ethyl 5-O-methyl (2Z)-2-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3,3-dimethylpentanedioate?
The InChIKey is HPXMNBRMYZDARH-FYWRMAATSA-N. The full InChI is InChI=1S/C18H34O5Si/c1-11-22-16(20)15(18(6,7)12-14(19)21-8)13(2)23-24(9,10)17(3,4)5/h11-12H2,1-10H3/b15-13+.
What are the key properties of 1-O-ethyl 5-O-methyl (2Z)-2-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3,3-dimethylpentanedioate?
1-O-ethyl 5-O-methyl (2Z)-2-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3,3-dimethylpentanedioate has a molecular weight of 358.55 g/mol, XLogP of 4.43, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 5-O-methyl (2Z)-2-[1-[tert-butyl(dimethyl)silyl]oxyethylidene]-3,3-dimethylpentanedioate is sourced from PubChem (CID 13208592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).