C14H17N3O — CID 13210052
3,3-dimethyl-4-phenyl-1-(1,2,4-triazol-1-yl)butan-2-one (PubChem CID 13210052) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 3,3-dimethyl-4-phenyl-1-(1,2,4-triazol-1-yl)butan-2-one.
| Compound Name | 3,3-dimethyl-4-phenyl-1-(1,2,4-triazol-1-yl)butan-2-one |
|---|---|
| PubChem CID | 13210052 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3,3-dimethyl-4-phenyl-1-(1,2,4-triazol-1-yl)butan-2-one |
| SMILES | CC(C)(Cc1ccccc1)C(=O)Cn1cncn1 |
| InChI | InChI=1S/C14H17N3O/c1-14(2,8-12-6-4-3-5-7-12)13(18)9-17-11-15-10-16-17/h3-7,10-11H,8-9H2,1-2H3 |
| InChIKey | XPKKSNIEXSYZMO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |