About (2S)-N,N-diethyl-5-oxopyrrolidine-2-carboxamide
(2S)-N,N-diethyl-5-oxopyrrolidine-2-carboxamide (PubChem CID 13210764) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is (2S)-N,N-diethyl-5-oxopyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-N,N-diethyl-5-oxopyrrolidine-2-carboxamide |
| PubChem CID | 13210764 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (2S)-N,N-diethyl-5-oxopyrrolidine-2-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C9H16N2O2/c1-3-11(4-2)9(13)7-5-6-8(12)10-7/h7H,3-6H2,1-2H3,(H,10,12)/t7-/m0/s1 |
| InChIKey | IZCZSKAHNSOBSI-ZETCQYMHSA-N |
| XLogP | 0.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-N,N-diethyl-5-oxopyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,N-diethyl-5-oxopyrrolidine-2-carboxamide?
The IUPAC name of (2S)-N,N-diethyl-5-oxopyrrolidine-2-carboxamide (CID 13210764) is (2S)-N,N-diethyl-5-oxopyrrolidine-2-carboxamide.
What is the SMILES notation for (2S)-N,N-diethyl-5-oxopyrrolidine-2-carboxamide?
The canonical SMILES for (2S)-N,N-diethyl-5-oxopyrrolidine-2-carboxamide is CCN(CC)C(=O)[C@@H]1CCC(=O)N1.
What is the InChIKey of (2S)-N,N-diethyl-5-oxopyrrolidine-2-carboxamide?
The InChIKey is IZCZSKAHNSOBSI-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-3-11(4-2)9(13)7-5-6-8(12)10-7/h7H,3-6H2,1-2H3,(H,10,12)/t7-/m0/s1.
What are the key properties of (2S)-N,N-diethyl-5-oxopyrrolidine-2-carboxamide?
(2S)-N,N-diethyl-5-oxopyrrolidine-2-carboxamide has a molecular weight of 184.24 g/mol, XLogP of 0.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N-diethyl-5-oxopyrrolidine-2-carboxamide is sourced from PubChem (CID 13210764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).