About 2-hydrazinyl-1,5-dimethylimidazo[4,5-d]pyridazin-4-one
2-hydrazinyl-1,5-dimethylimidazo[4,5-d]pyridazin-4-one (PubChem CID 13211291) has the molecular formula C7H10N6O
and a molecular weight of 194.20 g/mol. Its IUPAC name is 2-hydrazinyl-1,5-dimethylimidazo[4,5-d]pyridazin-4-one.
Molecular Properties
| Compound Name | 2-hydrazinyl-1,5-dimethylimidazo[4,5-d]pyridazin-4-one |
| PubChem CID | 13211291 |
| Molecular Formula | C7H10N6O |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-hydrazinyl-1,5-dimethylimidazo[4,5-d]pyridazin-4-one |
| SMILES | Cn1ncc2c(nc(NN)n2C)c1=O |
| InChI | InChI=1S/C7H10N6O/c1-12-4-3-9-13(2)6(14)5(4)10-7(12)11-8/h3H,8H2,1-2H3,(H,10,11) |
| InChIKey | MCYMOZKEPOWQQS-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydrazinyl-1,5-dimethylimidazo[4,5-d]pyridazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydrazinyl-1,5-dimethylimidazo[4,5-d]pyridazin-4-one?
The IUPAC name of 2-hydrazinyl-1,5-dimethylimidazo[4,5-d]pyridazin-4-one (CID 13211291) is 2-hydrazinyl-1,5-dimethylimidazo[4,5-d]pyridazin-4-one.
What is the SMILES notation for 2-hydrazinyl-1,5-dimethylimidazo[4,5-d]pyridazin-4-one?
The canonical SMILES for 2-hydrazinyl-1,5-dimethylimidazo[4,5-d]pyridazin-4-one is Cn1ncc2c(nc(NN)n2C)c1=O.
What is the InChIKey of 2-hydrazinyl-1,5-dimethylimidazo[4,5-d]pyridazin-4-one?
The InChIKey is MCYMOZKEPOWQQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N6O/c1-12-4-3-9-13(2)6(14)5(4)10-7(12)11-8/h3H,8H2,1-2H3,(H,10,11).
What are the key properties of 2-hydrazinyl-1,5-dimethylimidazo[4,5-d]pyridazin-4-one?
2-hydrazinyl-1,5-dimethylimidazo[4,5-d]pyridazin-4-one has a molecular weight of 194.20 g/mol, XLogP of -1.05, 1 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydrazinyl-1,5-dimethylimidazo[4,5-d]pyridazin-4-one is sourced from PubChem (CID 13211291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).