About 1-(1-trimethylsilylhexa-1,2-dienyl)cyclohexan-1-ol
1-(1-trimethylsilylhexa-1,2-dienyl)cyclohexan-1-ol (PubChem CID 13211421) has the molecular formula C15H28OSi
and a molecular weight of 252.47 g/mol. Its IUPAC name is 1-(1-trimethylsilylhexa-1,2-dienyl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-(1-trimethylsilylhexa-1,2-dienyl)cyclohexan-1-ol |
| PubChem CID | 13211421 |
| Molecular Formula | C15H28OSi |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 1-(1-trimethylsilylhexa-1,2-dienyl)cyclohexan-1-ol |
| SMILES | CCCC=C=C(C1(O)CCCCC1)[Si](C)(C)C |
| InChI | InChI=1S/C15H28OSi/c1-5-6-8-11-14(17(2,3)4)15(16)12-9-7-10-13-15/h8,16H,5-7,9-10,12-13H2,1-4H3 |
| InChIKey | XFUBKGHVWABABC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-trimethylsilylhexa-1,2-dienyl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-trimethylsilylhexa-1,2-dienyl)cyclohexan-1-ol?
The IUPAC name of 1-(1-trimethylsilylhexa-1,2-dienyl)cyclohexan-1-ol (CID 13211421) is 1-(1-trimethylsilylhexa-1,2-dienyl)cyclohexan-1-ol.
What is the SMILES notation for 1-(1-trimethylsilylhexa-1,2-dienyl)cyclohexan-1-ol?
The canonical SMILES for 1-(1-trimethylsilylhexa-1,2-dienyl)cyclohexan-1-ol is CCCC=C=C(C1(O)CCCCC1)[Si](C)(C)C.
What is the InChIKey of 1-(1-trimethylsilylhexa-1,2-dienyl)cyclohexan-1-ol?
The InChIKey is XFUBKGHVWABABC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28OSi/c1-5-6-8-11-14(17(2,3)4)15(16)12-9-7-10-13-15/h8,16H,5-7,9-10,12-13H2,1-4H3.
What are the key properties of 1-(1-trimethylsilylhexa-1,2-dienyl)cyclohexan-1-ol?
1-(1-trimethylsilylhexa-1,2-dienyl)cyclohexan-1-ol has a molecular weight of 252.47 g/mol, XLogP of 4.44, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-trimethylsilylhexa-1,2-dienyl)cyclohexan-1-ol is sourced from PubChem (CID 13211421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).