C16H16NO+ — CID 13211587
2-(2-methoxyphenyl)-3,4-dihydroisoquinolin-2-ium (PubChem CID 13211587) has the molecular formula C16H16NO+ and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-3,4-dihydroisoquinolin-2-ium.
| Compound Name | 2-(2-methoxyphenyl)-3,4-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 13211587 |
| Molecular Formula | C16H16NO+ |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-(2-methoxyphenyl)-3,4-dihydroisoquinolin-2-ium |
| SMILES | COc1ccccc1[N+]1=Cc2ccccc2CC1 |
| InChI | InChI=1S/C16H16NO/c1-18-16-9-5-4-8-15(16)17-11-10-13-6-2-3-7-14(13)12-17/h2-9,12H,10-11H2,1H3/q+1 |
| InChIKey | WGLBYYJLCIOHPB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|