About 1-(3-methoxycyclohexa-1,3-dien-1-yl)piperidine
1-(3-methoxycyclohexa-1,3-dien-1-yl)piperidine (PubChem CID 13211647) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-(3-methoxycyclohexa-1,3-dien-1-yl)piperidine.
Molecular Properties
| Compound Name | 1-(3-methoxycyclohexa-1,3-dien-1-yl)piperidine |
| PubChem CID | 13211647 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-(3-methoxycyclohexa-1,3-dien-1-yl)piperidine |
| SMILES | COC1=CCCC(N2CCCCC2)=C1 |
| InChI | InChI=1S/C12H19NO/c1-14-12-7-5-6-11(10-12)13-8-3-2-4-9-13/h7,10H,2-6,8-9H2,1H3 |
| InChIKey | XQCROGKLRJNJDK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-methoxycyclohexa-1,3-dien-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methoxycyclohexa-1,3-dien-1-yl)piperidine?
The IUPAC name of 1-(3-methoxycyclohexa-1,3-dien-1-yl)piperidine (CID 13211647) is 1-(3-methoxycyclohexa-1,3-dien-1-yl)piperidine.
What is the SMILES notation for 1-(3-methoxycyclohexa-1,3-dien-1-yl)piperidine?
The canonical SMILES for 1-(3-methoxycyclohexa-1,3-dien-1-yl)piperidine is COC1=CCCC(N2CCCCC2)=C1.
What is the InChIKey of 1-(3-methoxycyclohexa-1,3-dien-1-yl)piperidine?
The InChIKey is XQCROGKLRJNJDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-14-12-7-5-6-11(10-12)13-8-3-2-4-9-13/h7,10H,2-6,8-9H2,1H3.
What are the key properties of 1-(3-methoxycyclohexa-1,3-dien-1-yl)piperidine?
1-(3-methoxycyclohexa-1,3-dien-1-yl)piperidine has a molecular weight of 193.29 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methoxycyclohexa-1,3-dien-1-yl)piperidine is sourced from PubChem (CID 13211647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).