About 1-(5-methoxy-3,3-dimethylcyclohexa-1,5-dien-1-yl)piperidine
1-(5-methoxy-3,3-dimethylcyclohexa-1,5-dien-1-yl)piperidine (PubChem CID 13211649) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-(5-methoxy-3,3-dimethylcyclohexa-1,5-dien-1-yl)piperidine.
Molecular Properties
| Compound Name | 1-(5-methoxy-3,3-dimethylcyclohexa-1,5-dien-1-yl)piperidine |
| PubChem CID | 13211649 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-(5-methoxy-3,3-dimethylcyclohexa-1,5-dien-1-yl)piperidine |
| SMILES | COC1=CC(N2CCCCC2)=CC(C)(C)C1 |
| InChI | InChI=1S/C14H23NO/c1-14(2)10-12(9-13(11-14)16-3)15-7-5-4-6-8-15/h9-10H,4-8,11H2,1-3H3 |
| InChIKey | GDPNSRNZOMWOCS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-methoxy-3,3-dimethylcyclohexa-1,5-dien-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methoxy-3,3-dimethylcyclohexa-1,5-dien-1-yl)piperidine?
The IUPAC name of 1-(5-methoxy-3,3-dimethylcyclohexa-1,5-dien-1-yl)piperidine (CID 13211649) is 1-(5-methoxy-3,3-dimethylcyclohexa-1,5-dien-1-yl)piperidine.
What is the SMILES notation for 1-(5-methoxy-3,3-dimethylcyclohexa-1,5-dien-1-yl)piperidine?
The canonical SMILES for 1-(5-methoxy-3,3-dimethylcyclohexa-1,5-dien-1-yl)piperidine is COC1=CC(N2CCCCC2)=CC(C)(C)C1.
What is the InChIKey of 1-(5-methoxy-3,3-dimethylcyclohexa-1,5-dien-1-yl)piperidine?
The InChIKey is GDPNSRNZOMWOCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO/c1-14(2)10-12(9-13(11-14)16-3)15-7-5-4-6-8-15/h9-10H,4-8,11H2,1-3H3.
What are the key properties of 1-(5-methoxy-3,3-dimethylcyclohexa-1,5-dien-1-yl)piperidine?
1-(5-methoxy-3,3-dimethylcyclohexa-1,5-dien-1-yl)piperidine has a molecular weight of 221.34 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methoxy-3,3-dimethylcyclohexa-1,5-dien-1-yl)piperidine is sourced from PubChem (CID 13211649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).