About 4-benzyl-2,2-dimethyl-3H-pyrido[3,2-b][1,4]oxazine
4-benzyl-2,2-dimethyl-3H-pyrido[3,2-b][1,4]oxazine (PubChem CID 13212020) has the molecular formula C16H18N2O
and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-benzyl-2,2-dimethyl-3H-pyrido[3,2-b][1,4]oxazine.
Molecular Properties
| Compound Name | 4-benzyl-2,2-dimethyl-3H-pyrido[3,2-b][1,4]oxazine |
| PubChem CID | 13212020 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 4-benzyl-2,2-dimethyl-3H-pyrido[3,2-b][1,4]oxazine |
| SMILES | CC1(C)CN(Cc2ccccc2)c2ncccc2O1 |
| InChI | InChI=1S/C16H18N2O/c1-16(2)12-18(11-13-7-4-3-5-8-13)15-14(19-16)9-6-10-17-15/h3-10H,11-12H2,1-2H3 |
| InChIKey | YOKJGYWUICLWDS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-benzyl-2,2-dimethyl-3H-pyrido[3,2-b][1,4]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-2,2-dimethyl-3H-pyrido[3,2-b][1,4]oxazine?
The IUPAC name of 4-benzyl-2,2-dimethyl-3H-pyrido[3,2-b][1,4]oxazine (CID 13212020) is 4-benzyl-2,2-dimethyl-3H-pyrido[3,2-b][1,4]oxazine.
What is the SMILES notation for 4-benzyl-2,2-dimethyl-3H-pyrido[3,2-b][1,4]oxazine?
The canonical SMILES for 4-benzyl-2,2-dimethyl-3H-pyrido[3,2-b][1,4]oxazine is CC1(C)CN(Cc2ccccc2)c2ncccc2O1.
What is the InChIKey of 4-benzyl-2,2-dimethyl-3H-pyrido[3,2-b][1,4]oxazine?
The InChIKey is YOKJGYWUICLWDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O/c1-16(2)12-18(11-13-7-4-3-5-8-13)15-14(19-16)9-6-10-17-15/h3-10H,11-12H2,1-2H3.
What are the key properties of 4-benzyl-2,2-dimethyl-3H-pyrido[3,2-b][1,4]oxazine?
4-benzyl-2,2-dimethyl-3H-pyrido[3,2-b][1,4]oxazine has a molecular weight of 254.33 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-2,2-dimethyl-3H-pyrido[3,2-b][1,4]oxazine is sourced from PubChem (CID 13212020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).