About 2-diazo-1,1,3,3-tetramethylcycloheptane
2-diazo-1,1,3,3-tetramethylcycloheptane (PubChem CID 13212155) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 2-diazo-1,1,3,3-tetramethylcycloheptane.
Molecular Properties
| Compound Name | 2-diazo-1,1,3,3-tetramethylcycloheptane |
| PubChem CID | 13212155 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 2-diazo-1,1,3,3-tetramethylcycloheptane |
| SMILES | CC1(C)CCCCC(C)(C)C1=[N+]=[N-] |
| InChI | InChI=1S/C11H20N2/c1-10(2)7-5-6-8-11(3,4)9(10)13-12/h5-8H2,1-4H3 |
| InChIKey | ZBLCSODZDUILPP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-diazo-1,1,3,3-tetramethylcycloheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazo-1,1,3,3-tetramethylcycloheptane?
The IUPAC name of 2-diazo-1,1,3,3-tetramethylcycloheptane (CID 13212155) is 2-diazo-1,1,3,3-tetramethylcycloheptane.
What is the SMILES notation for 2-diazo-1,1,3,3-tetramethylcycloheptane?
The canonical SMILES for 2-diazo-1,1,3,3-tetramethylcycloheptane is CC1(C)CCCCC(C)(C)C1=[N+]=[N-].
What is the InChIKey of 2-diazo-1,1,3,3-tetramethylcycloheptane?
The InChIKey is ZBLCSODZDUILPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-10(2)7-5-6-8-11(3,4)9(10)13-12/h5-8H2,1-4H3.
What are the key properties of 2-diazo-1,1,3,3-tetramethylcycloheptane?
2-diazo-1,1,3,3-tetramethylcycloheptane has a molecular weight of 180.29 g/mol, XLogP of 3.28, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazo-1,1,3,3-tetramethylcycloheptane is sourced from PubChem (CID 13212155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).