About (E)-5,5-dimethyl-4-methylidene-1-trimethylsilylhex-1-en-3-ol
(E)-5,5-dimethyl-4-methylidene-1-trimethylsilylhex-1-en-3-ol (PubChem CID 13212263) has the molecular formula C12H24OSi
and a molecular weight of 212.41 g/mol. Its IUPAC name is (E)-5,5-dimethyl-4-methylidene-1-trimethylsilylhex-1-en-3-ol.
Molecular Properties
| Compound Name | (E)-5,5-dimethyl-4-methylidene-1-trimethylsilylhex-1-en-3-ol |
| PubChem CID | 13212263 |
| Molecular Formula | C12H24OSi |
| Molecular Weight | 212.41 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | (E)-5,5-dimethyl-4-methylidene-1-trimethylsilylhex-1-en-3-ol |
| SMILES | C=C(C(O)/C=C/[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H24OSi/c1-10(12(2,3)4)11(13)8-9-14(5,6)7/h8-9,11,13H,1H2,2-7H3/b9-8+ |
| InChIKey | WABHXEOGAVIZHJ-CMDGGOBGSA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5,5-dimethyl-4-methylidene-1-trimethylsilylhex-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5,5-dimethyl-4-methylidene-1-trimethylsilylhex-1-en-3-ol?
The IUPAC name of (E)-5,5-dimethyl-4-methylidene-1-trimethylsilylhex-1-en-3-ol (CID 13212263) is (E)-5,5-dimethyl-4-methylidene-1-trimethylsilylhex-1-en-3-ol.
What is the SMILES notation for (E)-5,5-dimethyl-4-methylidene-1-trimethylsilylhex-1-en-3-ol?
The canonical SMILES for (E)-5,5-dimethyl-4-methylidene-1-trimethylsilylhex-1-en-3-ol is C=C(C(O)/C=C/[Si](C)(C)C)C(C)(C)C.
What is the InChIKey of (E)-5,5-dimethyl-4-methylidene-1-trimethylsilylhex-1-en-3-ol?
The InChIKey is WABHXEOGAVIZHJ-CMDGGOBGSA-N. The full InChI is InChI=1S/C12H24OSi/c1-10(12(2,3)4)11(13)8-9-14(5,6)7/h8-9,11,13H,1H2,2-7H3/b9-8+.
What are the key properties of (E)-5,5-dimethyl-4-methylidene-1-trimethylsilylhex-1-en-3-ol?
(E)-5,5-dimethyl-4-methylidene-1-trimethylsilylhex-1-en-3-ol has a molecular weight of 212.41 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5,5-dimethyl-4-methylidene-1-trimethylsilylhex-1-en-3-ol is sourced from PubChem (CID 13212263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).