C26H20N2P2 — CID 13212319
2-N,4-N,1,3-tetraphenyl-1,3-diphosphetane-2,4-diimine (PubChem CID 13212319) has the molecular formula C26H20N2P2 and a molecular weight of 422.41 g/mol. Its IUPAC name is 2-N,4-N,1,3-tetraphenyl-1,3-diphosphetane-2,4-diimine.
| Compound Name | 2-N,4-N,1,3-tetraphenyl-1,3-diphosphetane-2,4-diimine |
|---|---|
| PubChem CID | 13212319 |
| Molecular Formula | C26H20N2P2 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 2-N,4-N,1,3-tetraphenyl-1,3-diphosphetane-2,4-diimine |
| SMILES | c1ccc(N=C2P(c3ccccc3)C(=Nc3ccccc3)P2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H20N2P2/c1-5-13-21(14-6-1)27-25-29(23-17-9-3-10-18-23)26(28-22-15-7-2-8-16-22)30(25)24-19-11-4-12-20-24/h1-20H/b27-25-,28-26+ |
| InChIKey | BIUXQDMVZZKQCH-ZQZMJUSDSA-N |
| XLogP | 6.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|