C18H20N2P2 — CID 13212320
1,3-diethyl-2-N,4-N-diphenyl-1,3-diphosphetane-2,4-diimine (PubChem CID 13212320) has the molecular formula C18H20N2P2 and a molecular weight of 326.32 g/mol. Its IUPAC name is 1,3-diethyl-2-N,4-N-diphenyl-1,3-diphosphetane-2,4-diimine.
| Compound Name | 1,3-diethyl-2-N,4-N-diphenyl-1,3-diphosphetane-2,4-diimine |
|---|---|
| PubChem CID | 13212320 |
| Molecular Formula | C18H20N2P2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 1,3-diethyl-2-N,4-N-diphenyl-1,3-diphosphetane-2,4-diimine |
| SMILES | CCP1C(=Nc2ccccc2)P(CC)C1=Nc1ccccc1 |
| InChI | InChI=1S/C18H20N2P2/c1-3-21-17(19-15-11-7-5-8-12-15)22(4-2)18(21)20-16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3/b19-17-,20-18+ |
| InChIKey | OLGKJSIWQNPCSD-YAFCTCPESA-N |
| XLogP | 6.38 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|